C13H18N2O4S — CID 62540597
methyl 3-(pyrrolidin-2-ylmethylsulfamoyl)benzoate (PubChem CID 62540597) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl 3-(pyrrolidin-2-ylmethylsulfamoyl)benzoate.
| Compound Name | methyl 3-(pyrrolidin-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 62540597 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | methyl 3-(pyrrolidin-2-ylmethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NCC2CCCN2)c1 |
| InChI | InChI=1S/C13H18N2O4S/c1-19-13(16)10-4-2-6-12(8-10)20(17,18)15-9-11-5-3-7-14-11/h2,4,6,8,11,14-15H,3,5,7,9H2,1H3 |
| InChIKey | VIWULBAWIAVADF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |