C13H20ClN3O4S — CID 119974021
2-methoxy-5-(pyrrolidin-2-ylmethylsulfamoyl)benzamide;hydrochloride (PubChem CID 119974021) has the molecular formula C13H20ClN3O4S and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-methoxy-5-(pyrrolidin-2-ylmethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | 2-methoxy-5-(pyrrolidin-2-ylmethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119974021 |
| Molecular Formula | C13H20ClN3O4S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-methoxy-5-(pyrrolidin-2-ylmethylsulfamoyl)benzamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)NCC2CCCN2)cc1C(N)=O.Cl |
| InChI | InChI=1S/C13H19N3O4S.ClH/c1-20-12-5-4-10(7-11(12)13(14)17)21(18,19)16-8-9-3-2-6-15-9;/h4-5,7,9,15-16H,2-3,6,8H2,1H3,(H2,14,17);1H |
| InChIKey | INAFCDRXEOMMMQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |