C13H18N2O5S — CID 103548901
methyl 3-(morpholin-3-ylmethylsulfamoyl)benzoate (PubChem CID 103548901) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is methyl 3-(morpholin-3-ylmethylsulfamoyl)benzoate.
| Compound Name | methyl 3-(morpholin-3-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 103548901 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | methyl 3-(morpholin-3-ylmethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NCC2COCCN2)c1 |
| InChI | InChI=1S/C13H18N2O5S/c1-19-13(16)10-3-2-4-12(7-10)21(17,18)15-8-11-9-20-6-5-14-11/h2-4,7,11,14-15H,5-6,8-9H2,1H3 |
| InChIKey | OPPTWWRCANPTKC-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |