C11H14F2N2O3S — CID 103548886
2,5-difluoro-N-(morpholin-3-ylmethyl)benzenesulfonamide (PubChem CID 103548886) has the molecular formula C11H14F2N2O3S and a molecular weight of 292.31 g/mol. Its IUPAC name is 2,5-difluoro-N-(morpholin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-(morpholin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103548886 |
| Molecular Formula | C11H14F2N2O3S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2,5-difluoro-N-(morpholin-3-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1COCCN1)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H14F2N2O3S/c12-8-1-2-10(13)11(5-8)19(16,17)15-6-9-7-18-4-3-14-9/h1-2,5,9,14-15H,3-4,6-7H2 |
| InChIKey | BFVILIFEJFXAHH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |