C12H16F2N2O2S — CID 43344425
2,5-difluoro-N-(piperidin-2-ylmethyl)benzenesulfonamide (PubChem CID 43344425) has the molecular formula C12H16F2N2O2S and a molecular weight of 290.33 g/mol. Its IUPAC name is 2,5-difluoro-N-(piperidin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-(piperidin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43344425 |
| Molecular Formula | C12H16F2N2O2S |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2,5-difluoro-N-(piperidin-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCCN1)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H16F2N2O2S/c13-9-4-5-11(14)12(7-9)19(17,18)16-8-10-3-1-2-6-15-10/h4-5,7,10,15-16H,1-3,6,8H2 |
| InChIKey | JVYSNRMXQBRXTC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |