C12H20N2O3S — CID 86784602
2,5-dimethyl-N-(piperidin-2-ylmethyl)furan-3-sulfonamide (PubChem CID 86784602) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2,5-dimethyl-N-(piperidin-2-ylmethyl)furan-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-(piperidin-2-ylmethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 86784602 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2,5-dimethyl-N-(piperidin-2-ylmethyl)furan-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC2CCCCN2)c(C)o1 |
| InChI | InChI=1S/C12H20N2O3S/c1-9-7-12(10(2)17-9)18(15,16)14-8-11-5-3-4-6-13-11/h7,11,13-14H,3-6,8H2,1-2H3 |
| InChIKey | MAJXISLAJUKTQP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |