C18H17NO4S2 — CID 16832037
methyl 3-(1-phenylethylsulfamoyl)-1-benzothiophene-2-carboxylate (PubChem CID 16832037) has the molecular formula C18H17NO4S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl 3-(1-phenylethylsulfamoyl)-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-(1-phenylethylsulfamoyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 16832037 |
| Molecular Formula | C18H17NO4S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | methyl 3-(1-phenylethylsulfamoyl)-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2ccccc2c1S(=O)(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C18H17NO4S2/c1-12(13-8-4-3-5-9-13)19-25(21,22)17-14-10-6-7-11-15(14)24-16(17)18(20)23-2/h3-12,19H,1-2H3 |
| InChIKey | MOHRRKMUFYNSCJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |