C13H15NO5S2 — CID 63888560
3-(1-methoxypropan-2-ylsulfamoyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 63888560) has the molecular formula C13H15NO5S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(1-methoxypropan-2-ylsulfamoyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-(1-methoxypropan-2-ylsulfamoyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63888560 |
| Molecular Formula | C13H15NO5S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3-(1-methoxypropan-2-ylsulfamoyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | COCC(C)NS(=O)(=O)c1c(C(=O)O)sc2ccccc12 |
| InChI | InChI=1S/C13H15NO5S2/c1-8(7-19-2)14-21(17,18)12-9-5-3-4-6-10(9)20-11(12)13(15)16/h3-6,8,14H,7H2,1-2H3,(H,15,16) |
| InChIKey | LVKBXVGGKQYSBM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |