C12H10N2O4S2 — CID 63888953
3-(2-cyanoethylsulfamoyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 63888953) has the molecular formula C12H10N2O4S2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 3-(2-cyanoethylsulfamoyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-(2-cyanoethylsulfamoyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63888953 |
| Molecular Formula | C12H10N2O4S2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 3-(2-cyanoethylsulfamoyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | N#CCCNS(=O)(=O)c1c(C(=O)O)sc2ccccc12 |
| InChI | InChI=1S/C12H10N2O4S2/c13-6-3-7-14-20(17,18)11-8-4-1-2-5-9(8)19-10(11)12(15)16/h1-2,4-5,14H,3,7H2,(H,15,16) |
| InChIKey | CCPUGFIRYNYRQY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|