C20H16N2O5S2 — CID 167832232
3-[(7-methoxyquinolin-8-yl)methylsulfamoyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 167832232) has the molecular formula C20H16N2O5S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 3-[(7-methoxyquinolin-8-yl)methylsulfamoyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-[(7-methoxyquinolin-8-yl)methylsulfamoyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 167832232 |
| Molecular Formula | C20H16N2O5S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 3-[(7-methoxyquinolin-8-yl)methylsulfamoyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | COc1ccc2cccnc2c1CNS(=O)(=O)c1c(C(=O)O)sc2ccccc12 |
| InChI | InChI=1S/C20H16N2O5S2/c1-27-15-9-8-12-5-4-10-21-17(12)14(15)11-22-29(25,26)19-13-6-2-3-7-16(13)28-18(19)20(23)24/h2-10,22H,11H2,1H3,(H,23,24) |
| InChIKey | SCSPKFFYVDIWJI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |