C9H5NaO5S2 — CID 23714405
sodium 2-carboxy-1-benzothiophene-3-sulfonate (PubChem CID 23714405) has the molecular formula C9H5NaO5S2 and a molecular weight of 280.26 g/mol. Its IUPAC name is sodium 2-carboxy-1-benzothiophene-3-sulfonate.
| Compound Name | sodium 2-carboxy-1-benzothiophene-3-sulfonate |
|---|---|
| PubChem CID | 23714405 |
| Molecular Formula | C9H5NaO5S2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | sodium 2-carboxy-1-benzothiophene-3-sulfonate |
| SMILES | O=C(O)c1sc2ccccc2c1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H6O5S2.Na/c10-9(11)7-8(16(12,13)14)5-3-1-2-4-6(5)15-7;/h1-4H,(H,10,11)(H,12,13,14);/q;+1/p-1 |
| InChIKey | CVDNOOKQJJRTHD-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|