C17H24FN3O4S — CID 120712898
1-[1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpiperidin-3-yl]piperazin-2-one (PubChem CID 120712898) has the molecular formula C17H24FN3O4S and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpiperidin-3-yl]piperazin-2-one.
| Compound Name | 1-[1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpiperidin-3-yl]piperazin-2-one |
|---|---|
| PubChem CID | 120712898 |
| Molecular Formula | C17H24FN3O4S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpiperidin-3-yl]piperazin-2-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(N3CCNCC3=O)C2)c(C)c1F |
| InChI | InChI=1S/C17H24FN3O4S/c1-12-15(6-5-14(25-2)17(12)18)26(23,24)20-8-3-4-13(11-20)21-9-7-19-10-16(21)22/h5-6,13,19H,3-4,7-11H2,1-2H3 |
| InChIKey | LFOBHFVEHKFAEH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |