C16H23ClFN3O4S — CID 120712913
1-[1-(4-fluoro-3-methoxyphenyl)sulfonylpiperidin-3-yl]piperazin-2-one;hydrochloride (PubChem CID 120712913) has the molecular formula C16H23ClFN3O4S and a molecular weight of 407.90 g/mol. Its IUPAC name is 1-[1-(4-fluoro-3-methoxyphenyl)sulfonylpiperidin-3-yl]piperazin-2-one;hydrochloride.
| Compound Name | 1-[1-(4-fluoro-3-methoxyphenyl)sulfonylpiperidin-3-yl]piperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120712913 |
| Molecular Formula | C16H23ClFN3O4S |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-[1-(4-fluoro-3-methoxyphenyl)sulfonylpiperidin-3-yl]piperazin-2-one;hydrochloride |
| SMILES | COc1cc(S(=O)(=O)N2CCCC(N3CCNCC3=O)C2)ccc1F.Cl |
| InChI | InChI=1S/C16H22FN3O4S.ClH/c1-24-15-9-13(4-5-14(15)17)25(22,23)19-7-2-3-12(11-19)20-8-6-18-10-16(20)21;/h4-5,9,12,18H,2-3,6-8,10-11H2,1H3;1H |
| InChIKey | SRGXWQPFXABBPD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |