C17H22N4O4S — CID 120875722
3-methoxy-4-[3-(2-oxopiperazin-1-yl)piperidin-1-yl]sulfonylbenzonitrile (PubChem CID 120875722) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-methoxy-4-[3-(2-oxopiperazin-1-yl)piperidin-1-yl]sulfonylbenzonitrile.
| Compound Name | 3-methoxy-4-[3-(2-oxopiperazin-1-yl)piperidin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 120875722 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-methoxy-4-[3-(2-oxopiperazin-1-yl)piperidin-1-yl]sulfonylbenzonitrile |
| SMILES | COc1cc(C#N)ccc1S(=O)(=O)N1CCCC(N2CCNCC2=O)C1 |
| InChI | InChI=1S/C17H22N4O4S/c1-25-15-9-13(10-18)4-5-16(15)26(23,24)20-7-2-3-14(12-20)21-8-6-19-11-17(21)22/h4-5,9,14,19H,2-3,6-8,11-12H2,1H3 |
| InChIKey | OGVLKXYNNWADLW-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |