C13H18ClN3O3S — CID 120874332
4-(4-aminopiperidin-1-yl)sulfonyl-3-methoxybenzonitrile;hydrochloride (PubChem CID 120874332) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.82 g/mol. Its IUPAC name is 4-(4-aminopiperidin-1-yl)sulfonyl-3-methoxybenzonitrile;hydrochloride.
| Compound Name | 4-(4-aminopiperidin-1-yl)sulfonyl-3-methoxybenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 120874332 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-(4-aminopiperidin-1-yl)sulfonyl-3-methoxybenzonitrile;hydrochloride |
| SMILES | COc1cc(C#N)ccc1S(=O)(=O)N1CCC(N)CC1.Cl |
| InChI | InChI=1S/C13H17N3O3S.ClH/c1-19-12-8-10(9-14)2-3-13(12)20(17,18)16-6-4-11(15)5-7-16;/h2-3,8,11H,4-7,15H2,1H3;1H |
| InChIKey | NJBZGICUPHSBDT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |