C20H23N3O3S — CID 113081099
4-[4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazin-1-yl]benzonitrile (PubChem CID 113081099) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-[4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 113081099 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-[4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazin-1-yl]benzonitrile |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)N1CCN(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C20H23N3O3S/c1-15-12-19(26-3)20(13-16(15)2)27(24,25)23-10-8-22(9-11-23)18-6-4-17(14-21)5-7-18/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | GTUMTUQRUPQLSY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |