C19H20ClN3O2S — CID 55703269
4-[4-(4-chloro-2-methylphenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55703269) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is 4-[4-(4-chloro-2-methylphenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-(4-chloro-2-methylphenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55703269 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 4-[4-(4-chloro-2-methylphenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)N1CCCN(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C19H20ClN3O2S/c1-15-13-17(20)5-8-19(15)26(24,25)23-10-2-9-22(11-12-23)18-6-3-16(14-21)4-7-18/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | ZTWHUBNNODGLBB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |