C23H28N4O4S2 — CID 55703622
4-[4-(4-piperidin-1-ylsulfonylphenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55703622) has the molecular formula C23H28N4O4S2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 4-[4-(4-piperidin-1-ylsulfonylphenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-(4-piperidin-1-ylsulfonylphenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55703622 |
| Molecular Formula | C23H28N4O4S2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 4-[4-(4-piperidin-1-ylsulfonylphenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(S(=O)(=O)c3ccc(S(=O)(=O)N4CCCCC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N4O4S2/c24-19-20-5-7-21(8-6-20)25-13-4-16-27(18-17-25)33(30,31)23-11-9-22(10-12-23)32(28,29)26-14-2-1-3-15-26/h5-12H,1-4,13-18H2 |
| InChIKey | QRECJKWKLCRAEZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 101.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |