C16H16BrN3O2S2 — CID 55703300
4-[4-(5-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55703300) has the molecular formula C16H16BrN3O2S2 and a molecular weight of 426.36 g/mol. Its IUPAC name is 4-[4-(5-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-(5-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55703300 |
| Molecular Formula | C16H16BrN3O2S2 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 4-[4-(5-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(S(=O)(=O)c3ccc(Br)s3)CC2)cc1 |
| InChI | InChI=1S/C16H16BrN3O2S2/c17-15-6-7-16(23-15)24(21,22)20-9-1-8-19(10-11-20)14-4-2-13(12-18)3-5-14/h2-7H,1,8-11H2 |
| InChIKey | ZJKXXUSXTPEQLQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |