C17H21BrN2O5S2 — CID 3366921
1-(5-bromothiophen-2-yl)sulfonyl-4-(3,4,5-trimethoxyphenyl)piperazine (PubChem CID 3366921) has the molecular formula C17H21BrN2O5S2 and a molecular weight of 477.40 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-4-(3,4,5-trimethoxyphenyl)piperazine.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-(3,4,5-trimethoxyphenyl)piperazine |
|---|---|
| PubChem CID | 3366921 |
| Molecular Formula | C17H21BrN2O5S2 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-(3,4,5-trimethoxyphenyl)piperazine |
| SMILES | COc1cc(N2CCN(S(=O)(=O)c3ccc(Br)s3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H21BrN2O5S2/c1-23-13-10-12(11-14(24-2)17(13)25-3)19-6-8-20(9-7-19)27(21,22)16-5-4-15(18)26-16/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | XSMMRUUZRHAKDQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|