C16H19BrN2O3S2 — CID 22208036
1-(5-bromothiophen-2-yl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazine (PubChem CID 22208036) has the molecular formula C16H19BrN2O3S2 and a molecular weight of 431.38 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 22208036 |
| Molecular Formula | C16H19BrN2O3S2 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazine |
| SMILES | COc1cccc(CN2CCN(S(=O)(=O)c3ccc(Br)s3)CC2)c1 |
| InChI | InChI=1S/C16H19BrN2O3S2/c1-22-14-4-2-3-13(11-14)12-18-7-9-19(10-8-18)24(20,21)16-6-5-15(17)23-16/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | QHYBZDXYOAVZDW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |