C16H18BrN3O4S2 — CID 4071806
1-(5-bromothiophen-2-yl)sulfonyl-4-[(4-nitrophenyl)methyl]-1,4-diazepane (PubChem CID 4071806) has the molecular formula C16H18BrN3O4S2 and a molecular weight of 460.38 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-4-[(4-nitrophenyl)methyl]-1,4-diazepane.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-[(4-nitrophenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 4071806 |
| Molecular Formula | C16H18BrN3O4S2 |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-[(4-nitrophenyl)methyl]-1,4-diazepane |
| SMILES | O=[N+]([O-])c1ccc(CN2CCCN(S(=O)(=O)c3ccc(Br)s3)CC2)cc1 |
| InChI | InChI=1S/C16H18BrN3O4S2/c17-15-6-7-16(25-15)26(23,24)19-9-1-8-18(10-11-19)12-13-2-4-14(5-3-13)20(21)22/h2-7H,1,8-12H2 |
| InChIKey | ZBPVJZBYLAMFML-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|