C17H21BrN2O3S2 — CID 38799381
1-(5-bromothiophen-2-yl)sulfonyl-4-[2-(3-methylphenoxy)ethyl]piperazine (PubChem CID 38799381) has the molecular formula C17H21BrN2O3S2 and a molecular weight of 445.40 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-4-[2-(3-methylphenoxy)ethyl]piperazine.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-[2-(3-methylphenoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 38799381 |
| Molecular Formula | C17H21BrN2O3S2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-[2-(3-methylphenoxy)ethyl]piperazine |
| SMILES | Cc1cccc(OCCN2CCN(S(=O)(=O)c3ccc(Br)s3)CC2)c1 |
| InChI | InChI=1S/C17H21BrN2O3S2/c1-14-3-2-4-15(13-14)23-12-11-19-7-9-20(10-8-19)25(21,22)17-6-5-16(18)24-17/h2-6,13H,7-12H2,1H3 |
| InChIKey | WNRNCEOSFSTCEE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |