C18H24BrN5O2S2 — CID 122335073
1-[6-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane (PubChem CID 122335073) has the molecular formula C18H24BrN5O2S2 and a molecular weight of 486.46 g/mol. Its IUPAC name is 1-[6-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane.
| Compound Name | 1-[6-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane |
|---|---|
| PubChem CID | 122335073 |
| Molecular Formula | C18H24BrN5O2S2 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 1-[6-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane |
| SMILES | O=S(=O)(c1ccc(Br)s1)N1CCN(c2ccc(N3CCCCCC3)nn2)CC1 |
| InChI | InChI=1S/C18H24BrN5O2S2/c19-15-5-8-18(27-15)28(25,26)24-13-11-23(12-14-24)17-7-6-16(20-21-17)22-9-3-1-2-4-10-22/h5-8H,1-4,9-14H2 |
| InChIKey | VFIHVQUSDKDZJE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |