C19H27N5O2S2 — CID 122335925
3-(2-methylpiperidin-1-yl)-6-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]pyridazine (PubChem CID 122335925) has the molecular formula C19H27N5O2S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)-6-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]pyridazine.
| Compound Name | 3-(2-methylpiperidin-1-yl)-6-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 122335925 |
| Molecular Formula | C19H27N5O2S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)-6-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]pyridazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3ccc(N4CCCCC4C)nn3)CC2)s1 |
| InChI | InChI=1S/C19H27N5O2S2/c1-15-5-3-4-10-24(15)18-8-7-17(20-21-18)22-11-13-23(14-12-22)28(25,26)19-9-6-16(2)27-19/h6-9,15H,3-5,10-14H2,1-2H3 |
| InChIKey | XKDITAUYOGWZBQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |