C26H31N5O3S — CID 121053184
3-(2-methylpiperidin-1-yl)-6-[4-(4-phenoxyphenyl)sulfonylpiperazin-1-yl]pyridazine (PubChem CID 121053184) has the molecular formula C26H31N5O3S and a molecular weight of 493.63 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)-6-[4-(4-phenoxyphenyl)sulfonylpiperazin-1-yl]pyridazine.
| Compound Name | 3-(2-methylpiperidin-1-yl)-6-[4-(4-phenoxyphenyl)sulfonylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 121053184 |
| Molecular Formula | C26H31N5O3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)-6-[4-(4-phenoxyphenyl)sulfonylpiperazin-1-yl]pyridazine |
| SMILES | CC1CCCCN1c1ccc(N2CCN(S(=O)(=O)c3ccc(Oc4ccccc4)cc3)CC2)nn1 |
| InChI | InChI=1S/C26H31N5O3S/c1-21-7-5-6-16-31(21)26-15-14-25(27-28-26)29-17-19-30(20-18-29)35(32,33)24-12-10-23(11-13-24)34-22-8-3-2-4-9-22/h2-4,8-15,21H,5-7,16-20H2,1H3 |
| InChIKey | YJSPINCIEVEYAZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |