C24H29N5O3S — CID 121053157
N,N-diethyl-6-[4-(4-phenoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine (PubChem CID 121053157) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is N,N-diethyl-6-[4-(4-phenoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine.
| Compound Name | N,N-diethyl-6-[4-(4-phenoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 121053157 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N,N-diethyl-6-[4-(4-phenoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine |
| SMILES | CCN(CC)c1ccc(N2CCN(S(=O)(=O)c3ccc(Oc4ccccc4)cc3)CC2)nn1 |
| InChI | InChI=1S/C24H29N5O3S/c1-3-27(4-2)23-14-15-24(26-25-23)28-16-18-29(19-17-28)33(30,31)22-12-10-21(11-13-22)32-20-8-6-5-7-9-20/h5-15H,3-4,16-19H2,1-2H3 |
| InChIKey | BZCVYDLMTJOZDN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |