C16H20BrN5O3S2 — CID 122355490
4-[6-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine (PubChem CID 122355490) has the molecular formula C16H20BrN5O3S2 and a molecular weight of 474.41 g/mol. Its IUPAC name is 4-[6-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine.
| Compound Name | 4-[6-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine |
|---|---|
| PubChem CID | 122355490 |
| Molecular Formula | C16H20BrN5O3S2 |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 4-[6-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine |
| SMILES | O=S(=O)(c1ccc(Br)s1)N1CCN(c2cc(N3CCOCC3)cnn2)CC1 |
| InChI | InChI=1S/C16H20BrN5O3S2/c17-14-1-2-16(26-14)27(23,24)22-5-3-21(4-6-22)15-11-13(12-18-19-15)20-7-9-25-10-8-20/h1-2,11-12H,3-10H2 |
| InChIKey | QEUKTBMAIWAKJG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |