C22H25N3O5S — CID 3758703
8-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]sulfonylquinoline (PubChem CID 3758703) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 8-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]sulfonylquinoline.
| Compound Name | 8-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 3758703 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 8-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]sulfonylquinoline |
| SMILES | COc1cc(N2CCN(S(=O)(=O)c3cccc4cccnc34)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25N3O5S/c1-28-18-14-17(15-19(29-2)22(18)30-3)24-10-12-25(13-11-24)31(26,27)20-8-4-6-16-7-5-9-23-21(16)20/h4-9,14-15H,10-13H2,1-3H3 |
| InChIKey | WLTFTWIANKVGTR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|