C16H21N3O2S — CID 119974617
1-(1-quinolin-8-ylsulfonylpiperidin-4-yl)ethanamine (PubChem CID 119974617) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(1-quinolin-8-ylsulfonylpiperidin-4-yl)ethanamine.
| Compound Name | 1-(1-quinolin-8-ylsulfonylpiperidin-4-yl)ethanamine |
|---|---|
| PubChem CID | 119974617 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-(1-quinolin-8-ylsulfonylpiperidin-4-yl)ethanamine |
| SMILES | CC(N)C1CCN(S(=O)(=O)c2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C16H21N3O2S/c1-12(17)13-7-10-19(11-8-13)22(20,21)15-6-2-4-14-5-3-9-18-16(14)15/h2-6,9,12-13H,7-8,10-11,17H2,1H3 |
| InChIKey | SVTKIEWULAOERO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |