C22H25N5O2S — CID 126890465
N-cyclopropyl-6-methyl-N-(1-quinolin-8-ylsulfonylpiperidin-4-yl)pyrimidin-4-amine (PubChem CID 126890465) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-cyclopropyl-6-methyl-N-(1-quinolin-8-ylsulfonylpiperidin-4-yl)pyrimidin-4-amine.
| Compound Name | N-cyclopropyl-6-methyl-N-(1-quinolin-8-ylsulfonylpiperidin-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 126890465 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-cyclopropyl-6-methyl-N-(1-quinolin-8-ylsulfonylpiperidin-4-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(N(C2CC2)C2CCN(S(=O)(=O)c3cccc4cccnc34)CC2)ncn1 |
| InChI | InChI=1S/C22H25N5O2S/c1-16-14-21(25-15-24-16)27(18-7-8-18)19-9-12-26(13-10-19)30(28,29)20-6-2-4-17-5-3-11-23-22(17)20/h2-6,11,14-15,18-19H,7-10,12-13H2,1H3 |
| InChIKey | YFXDNZWUGJWNTG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |