C20H21N5O2S — CID 126858187
8-[[2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]quinoline (PubChem CID 126858187) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 8-[[2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]quinoline.
| Compound Name | 8-[[2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]quinoline |
|---|---|
| PubChem CID | 126858187 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 8-[[2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]quinoline |
| SMILES | Cc1cc(N2CC3CN(S(=O)(=O)c4cccc5cccnc45)CC3C2)ncn1 |
| InChI | InChI=1S/C20H21N5O2S/c1-14-8-19(23-13-22-14)24-9-16-11-25(12-17(16)10-24)28(26,27)18-6-2-4-15-5-3-7-21-20(15)18/h2-8,13,16-17H,9-12H2,1H3 |
| InChIKey | JATATVKVZJYPBV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |