C20H21N3O2S — CID 99816764
8-[4-(pyridin-2-ylmethyl)piperidin-1-yl]sulfonylquinoline (PubChem CID 99816764) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 8-[4-(pyridin-2-ylmethyl)piperidin-1-yl]sulfonylquinoline.
| Compound Name | 8-[4-(pyridin-2-ylmethyl)piperidin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 99816764 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 8-[4-(pyridin-2-ylmethyl)piperidin-1-yl]sulfonylquinoline |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCC(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C20H21N3O2S/c24-26(25,19-8-3-5-17-6-4-12-22-20(17)19)23-13-9-16(10-14-23)15-18-7-1-2-11-21-18/h1-8,11-12,16H,9-10,13-15H2 |
| InChIKey | HCZBROHKNZFYPH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |