C20H19FN2O4S2 — CID 121192622
7-(2-fluorophenyl)-4-quinolin-8-ylsulfonyl-1,4-thiazepane 1,1-dioxide (PubChem CID 121192622) has the molecular formula C20H19FN2O4S2 and a molecular weight of 434.51 g/mol. Its IUPAC name is 7-(2-fluorophenyl)-4-quinolin-8-ylsulfonyl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 7-(2-fluorophenyl)-4-quinolin-8-ylsulfonyl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 121192622 |
| Molecular Formula | C20H19FN2O4S2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 7-(2-fluorophenyl)-4-quinolin-8-ylsulfonyl-1,4-thiazepane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(S(=O)(=O)c2cccc3cccnc23)CCC1c1ccccc1F |
| InChI | InChI=1S/C20H19FN2O4S2/c21-17-8-2-1-7-16(17)18-10-12-23(13-14-28(18,24)25)29(26,27)19-9-3-5-15-6-4-11-22-20(15)19/h1-9,11,18H,10,12-14H2 |
| InChIKey | CPYBQISSPGJEIH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |