C18H23N3O2S — CID 131703897
8-[(4-cyclobutyl-1,4-diazepan-1-yl)sulfonyl]quinoline (PubChem CID 131703897) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 8-[(4-cyclobutyl-1,4-diazepan-1-yl)sulfonyl]quinoline.
| Compound Name | 8-[(4-cyclobutyl-1,4-diazepan-1-yl)sulfonyl]quinoline |
|---|---|
| PubChem CID | 131703897 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 8-[(4-cyclobutyl-1,4-diazepan-1-yl)sulfonyl]quinoline |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCCN(C2CCC2)CC1 |
| InChI | InChI=1S/C18H23N3O2S/c22-24(23,17-9-1-5-15-6-3-10-19-18(15)17)21-12-4-11-20(13-14-21)16-7-2-8-16/h1,3,5-6,9-10,16H,2,4,7-8,11-14H2 |
| InChIKey | IAMXCJLNSXCNDA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |