C16H19N3O2S — CID 22202524
8-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)quinoline (PubChem CID 22202524) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 8-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)quinoline.
| Compound Name | 8-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)quinoline |
|---|---|
| PubChem CID | 22202524 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 8-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)quinoline |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C16H19N3O2S/c20-22(21,19-11-10-18-9-3-6-14(18)12-19)15-7-1-4-13-5-2-8-17-16(13)15/h1-2,4-5,7-8,14H,3,6,9-12H2 |
| InChIKey | IAFPBCBORIIMPW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |