C20H21N5O2S — CID 122279795
8-[4-(6-cyclopropylpyridazin-3-yl)piperazin-1-yl]sulfonylquinoline (PubChem CID 122279795) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 8-[4-(6-cyclopropylpyridazin-3-yl)piperazin-1-yl]sulfonylquinoline.
| Compound Name | 8-[4-(6-cyclopropylpyridazin-3-yl)piperazin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 122279795 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 8-[4-(6-cyclopropylpyridazin-3-yl)piperazin-1-yl]sulfonylquinoline |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCN(c2ccc(C3CC3)nn2)CC1 |
| InChI | InChI=1S/C20H21N5O2S/c26-28(27,18-5-1-3-16-4-2-10-21-20(16)18)25-13-11-24(12-14-25)19-9-8-17(22-23-19)15-6-7-15/h1-5,8-10,15H,6-7,11-14H2 |
| InChIKey | XCVQZOJJAFZUJH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |