C17H18Cl2N4O2S — CID 122279772
3-cyclopropyl-6-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]pyridazine (PubChem CID 122279772) has the molecular formula C17H18Cl2N4O2S and a molecular weight of 413.33 g/mol. Its IUPAC name is 3-cyclopropyl-6-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]pyridazine.
| Compound Name | 3-cyclopropyl-6-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 122279772 |
| Molecular Formula | C17H18Cl2N4O2S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 3-cyclopropyl-6-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]pyridazine |
| SMILES | O=S(=O)(c1cccc(Cl)c1Cl)N1CCN(c2ccc(C3CC3)nn2)CC1 |
| InChI | InChI=1S/C17H18Cl2N4O2S/c18-13-2-1-3-15(17(13)19)26(24,25)23-10-8-22(9-11-23)16-7-6-14(20-21-16)12-4-5-12/h1-3,6-7,12H,4-5,8-11H2 |
| InChIKey | MURDYZSVPPVZLC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |