C21H28N4O2S — CID 122279803
3-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-6-cyclopropylpyridazine (PubChem CID 122279803) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is 3-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-6-cyclopropylpyridazine.
| Compound Name | 3-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-6-cyclopropylpyridazine |
|---|---|
| PubChem CID | 122279803 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 3-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-6-cyclopropylpyridazine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCN(c3ccc(C4CC4)nn3)CC2)cc1 |
| InChI | InChI=1S/C21H28N4O2S/c1-21(2,3)17-6-8-18(9-7-17)28(26,27)25-14-12-24(13-15-25)20-11-10-19(22-23-20)16-4-5-16/h6-11,16H,4-5,12-15H2,1-3H3 |
| InChIKey | PXIQYPLEYLSDPB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |