C18H24N4O2S — CID 121190319
1-[1-(4-tert-butylphenyl)sulfonylazetidin-3-yl]-4-cyclopropyltriazole (PubChem CID 121190319) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-[1-(4-tert-butylphenyl)sulfonylazetidin-3-yl]-4-cyclopropyltriazole.
| Compound Name | 1-[1-(4-tert-butylphenyl)sulfonylazetidin-3-yl]-4-cyclopropyltriazole |
|---|---|
| PubChem CID | 121190319 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[1-(4-tert-butylphenyl)sulfonylazetidin-3-yl]-4-cyclopropyltriazole |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CC(n3cc(C4CC4)nn3)C2)cc1 |
| InChI | InChI=1S/C18H24N4O2S/c1-18(2,3)14-6-8-16(9-7-14)25(23,24)21-10-15(11-21)22-12-17(19-20-22)13-4-5-13/h6-9,12-13,15H,4-5,10-11H2,1-3H3 |
| InChIKey | PQDLSIYLAGNRSR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |