C20H28N4O4S — CID 121065332
4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2,6-dimethoxypyrimidine (PubChem CID 121065332) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is 4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2,6-dimethoxypyrimidine.
| Compound Name | 4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 121065332 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2,6-dimethoxypyrimidine |
| SMILES | COc1cc(N2CCN(S(=O)(=O)c3ccc(C(C)(C)C)cc3)CC2)nc(OC)n1 |
| InChI | InChI=1S/C20H28N4O4S/c1-20(2,3)15-6-8-16(9-7-15)29(25,26)24-12-10-23(11-13-24)17-14-18(27-4)22-19(21-17)28-5/h6-9,14H,10-13H2,1-5H3 |
| InChIKey | ODTKKXZVSXTNAA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |