C21H31N5O2S — CID 53047736
4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-N-ethyl-6-methylpyrimidin-2-amine (PubChem CID 53047736) has the molecular formula C21H31N5O2S and a molecular weight of 417.58 g/mol. Its IUPAC name is 4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-N-ethyl-6-methylpyrimidin-2-amine.
| Compound Name | 4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-N-ethyl-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 53047736 |
| Molecular Formula | C21H31N5O2S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-N-ethyl-6-methylpyrimidin-2-amine |
| SMILES | CCNc1nc(C)cc(N2CCN(S(=O)(=O)c3ccc(C(C)(C)C)cc3)CC2)n1 |
| InChI | InChI=1S/C21H31N5O2S/c1-6-22-20-23-16(2)15-19(24-20)25-11-13-26(14-12-25)29(27,28)18-9-7-17(8-10-18)21(3,4)5/h7-10,15H,6,11-14H2,1-5H3,(H,22,23,24) |
| InChIKey | SHZGSACZEQGBCV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |