C17H22IN5O2S — CID 122351272
N-ethyl-4-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-2-amine (PubChem CID 122351272) has the molecular formula C17H22IN5O2S and a molecular weight of 487.37 g/mol. Its IUPAC name is N-ethyl-4-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-2-amine.
| Compound Name | N-ethyl-4-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 122351272 |
| Molecular Formula | C17H22IN5O2S |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | N-ethyl-4-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-2-amine |
| SMILES | CCNc1nc(C)cc(N2CCN(S(=O)(=O)c3ccc(I)cc3)CC2)n1 |
| InChI | InChI=1S/C17H22IN5O2S/c1-3-19-17-20-13(2)12-16(21-17)22-8-10-23(11-9-22)26(24,25)15-6-4-14(18)5-7-15/h4-7,12H,3,8-11H2,1-2H3,(H,19,20,21) |
| InChIKey | XVIPNADVGXJMCY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|