C24H25N3O4S — CID 3826075
4-benzyl-3-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,3-oxazolidin-2-one (PubChem CID 3826075) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-benzyl-3-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3826075 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 4-benzyl-3-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCC(Cc2ccccc2)N1C1CCN(S(=O)(=O)c2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C24H25N3O4S/c28-24-27(21(17-31-24)16-18-6-2-1-3-7-18)20-11-14-26(15-12-20)32(29,30)22-10-4-8-19-9-5-13-25-23(19)22/h1-10,13,20-21H,11-12,14-17H2 |
| InChIKey | SWZAAKPCWWIDBX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |