C22H20N4O3S — CID 24731346
3-phenyl-5-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazole (PubChem CID 24731346) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 3-phenyl-5-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-phenyl-5-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 24731346 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3-phenyl-5-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazole |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCC(c2nc(-c3ccccc3)no2)CC1 |
| InChI | InChI=1S/C22H20N4O3S/c27-30(28,19-10-4-8-16-9-5-13-23-20(16)19)26-14-11-18(12-15-26)22-24-21(25-29-22)17-6-2-1-3-7-17/h1-10,13,18H,11-12,14-15H2 |
| InChIKey | JOUOEVZMROKTRA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 89.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |