C19H18N4O5S — CID 19324632
5-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 19324632) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is 5-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19324632 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 5-[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCC(c3nc(-c4ccccc4)no3)CC2)cc1 |
| InChI | InChI=1S/C19H18N4O5S/c24-23(25)16-6-8-17(9-7-16)29(26,27)22-12-10-15(11-13-22)19-20-18(21-28-19)14-4-2-1-3-5-14/h1-9,15H,10-13H2 |
| InChIKey | XJJCKHMMVXHZIO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|