C22H19ClN4O3S — CID 42761067
3-(3-chlorophenyl)-5-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazole (PubChem CID 42761067) has the molecular formula C22H19ClN4O3S and a molecular weight of 454.94 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(3-chlorophenyl)-5-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 42761067 |
| Molecular Formula | C22H19ClN4O3S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 3-(3-chlorophenyl)-5-(1-quinolin-8-ylsulfonylpiperidin-4-yl)-1,2,4-oxadiazole |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCC(c2nc(-c3cccc(Cl)c3)no2)CC1 |
| InChI | InChI=1S/C22H19ClN4O3S/c23-18-7-1-5-17(14-18)21-25-22(30-26-21)16-9-12-27(13-10-16)31(28,29)19-8-2-4-15-6-3-11-24-20(15)19/h1-8,11,14,16H,9-10,12-13H2 |
| InChIKey | MGGYQQIBFMTEGO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 89.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |