C21H22N2O2S — CID 18338372
8-(4-methyl-4-phenylpiperidin-1-yl)sulfonylquinoline (PubChem CID 18338372) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 8-(4-methyl-4-phenylpiperidin-1-yl)sulfonylquinoline.
| Compound Name | 8-(4-methyl-4-phenylpiperidin-1-yl)sulfonylquinoline |
|---|---|
| PubChem CID | 18338372 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 8-(4-methyl-4-phenylpiperidin-1-yl)sulfonylquinoline |
| SMILES | CC1(c2ccccc2)CCN(S(=O)(=O)c2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C21H22N2O2S/c1-21(18-9-3-2-4-10-18)12-15-23(16-13-21)26(24,25)19-11-5-7-17-8-6-14-22-20(17)19/h2-11,14H,12-13,15-16H2,1H3 |
| InChIKey | XHMPBOXBBWQPGU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |