C24H29N3O2S — CID 23933018
8-[4-[(4-tert-butylphenyl)methyl]piperazin-1-yl]sulfonylquinoline (PubChem CID 23933018) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 8-[4-[(4-tert-butylphenyl)methyl]piperazin-1-yl]sulfonylquinoline.
| Compound Name | 8-[4-[(4-tert-butylphenyl)methyl]piperazin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 23933018 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 8-[4-[(4-tert-butylphenyl)methyl]piperazin-1-yl]sulfonylquinoline |
| SMILES | CC(C)(C)c1ccc(CN2CCN(S(=O)(=O)c3cccc4cccnc34)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O2S/c1-24(2,3)21-11-9-19(10-12-21)18-26-14-16-27(17-15-26)30(28,29)22-8-4-6-20-7-5-13-25-23(20)22/h4-13H,14-18H2,1-3H3 |
| InChIKey | VTTBZTKSDQYTRP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |