C27H27FN4O2S — CID 123344778
N-[4-[[4-[(4-fluorophenyl)methyl]piperazin-1-yl]methyl]phenyl]quinoline-8-sulfonamide (PubChem CID 123344778) has the molecular formula C27H27FN4O2S and a molecular weight of 490.60 g/mol. Its IUPAC name is N-[4-[[4-[(4-fluorophenyl)methyl]piperazin-1-yl]methyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[[4-[(4-fluorophenyl)methyl]piperazin-1-yl]methyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 123344778 |
| Molecular Formula | C27H27FN4O2S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-[4-[[4-[(4-fluorophenyl)methyl]piperazin-1-yl]methyl]phenyl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(CN2CCN(Cc3ccc(F)cc3)CC2)cc1)c1cccc2cccnc12 |
| InChI | InChI=1S/C27H27FN4O2S/c28-24-10-6-21(7-11-24)19-31-15-17-32(18-16-31)20-22-8-12-25(13-9-22)30-35(33,34)26-5-1-3-23-4-2-14-29-27(23)26/h1-14,30H,15-20H2 |
| InChIKey | NKUUAQMVANUWEP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |